C20H29IN4O — CID 111837478
1-ethyl-3-[2-(4-methylphenoxy)ethyl]-2-[2-(6-methyl-3-pyridinyl)ethyl]guanidine;hydroiodide (PubChem CID 111837478) has the molecular formula C20H29IN4O and a molecular weight of 468.38 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methylphenoxy)ethyl]-2-[2-(6-methyl-3-pyridinyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-methylphenoxy)ethyl]-2-[2-(6-methyl-3-pyridinyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111837478 |
| Molecular Formula | C20H29IN4O |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 1-ethyl-3-[2-(4-methylphenoxy)ethyl]-2-[2-(6-methyl-3-pyridinyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(C)nc1)NCCOc1ccc(C)cc1.I |
| InChI | InChI=1S/C20H28N4O.HI/c1-4-21-20(22-12-11-18-8-7-17(3)24-15-18)23-13-14-25-19-9-5-16(2)6-10-19;/h5-10,15H,4,11-14H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | PVGLFZPBOLSHOI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|