C13H23IN4 — CID 86777561
1,3-diethyl-2-[2-(6-methyl-3-pyridinyl)ethyl]guanidine;hydroiodide (PubChem CID 86777561) has the molecular formula C13H23IN4 and a molecular weight of 362.26 g/mol. Its IUPAC name is 1,3-diethyl-2-[2-(6-methyl-3-pyridinyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1,3-diethyl-2-[2-(6-methyl-3-pyridinyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 86777561 |
| Molecular Formula | C13H23IN4 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1,3-diethyl-2-[2-(6-methyl-3-pyridinyl)ethyl]guanidine;hydroiodide |
| SMILES | CCNC(=NCCc1ccc(C)nc1)NCC.I |
| InChI | InChI=1S/C13H22N4.HI/c1-4-14-13(15-5-2)16-9-8-12-7-6-11(3)17-10-12;/h6-7,10H,4-5,8-9H2,1-3H3,(H2,14,15,16);1H |
| InChIKey | XBUAYSFYSIJVKX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|