C22H30FN5O2 — CID 111837842
1-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-(2-pyridin-3-yloxyethyl)guanidine (PubChem CID 111837842) has the molecular formula C22H30FN5O2 and a molecular weight of 415.51 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-(2-pyridin-3-yloxyethyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-(2-pyridin-3-yloxyethyl)guanidine |
|---|---|
| PubChem CID | 111837842 |
| Molecular Formula | C22H30FN5O2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-(2-pyridin-3-yloxyethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(F)cc1)N1CCOCC1)NCCOc1cccnc1 |
| InChI | InChI=1S/C22H30FN5O2/c1-2-25-22(26-10-13-30-20-4-3-9-24-16-20)27-17-21(28-11-14-29-15-12-28)18-5-7-19(23)8-6-18/h3-9,16,21H,2,10-15,17H2,1H3,(H2,25,26,27) |
| InChIKey | GHYPDXZPYAKCJB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|