C16H27N5O2 — CID 111835729
1-ethyl-2-(2-morpholin-4-ylethyl)-3-(2-pyridin-3-yloxyethyl)guanidine (PubChem CID 111835729) has the molecular formula C16H27N5O2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-ethyl-2-(2-morpholin-4-ylethyl)-3-(2-pyridin-3-yloxyethyl)guanidine.
| Compound Name | 1-ethyl-2-(2-morpholin-4-ylethyl)-3-(2-pyridin-3-yloxyethyl)guanidine |
|---|---|
| PubChem CID | 111835729 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 1-ethyl-2-(2-morpholin-4-ylethyl)-3-(2-pyridin-3-yloxyethyl)guanidine |
| SMILES | CCN/C(=N\CCN1CCOCC1)NCCOc1cccnc1 |
| InChI | InChI=1S/C16H27N5O2/c1-2-18-16(19-6-8-21-9-12-22-13-10-21)20-7-11-23-15-4-3-5-17-14-15/h3-5,14H,2,6-13H2,1H3,(H2,18,19,20) |
| InChIKey | HWMGBXJLODMQLG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|