C13H20O4 — CID 11184051
ethyl 2-[(2R,4S)-2-[(2R)-but-3-en-2-yl]-6-oxooxan-4-yl]acetate (PubChem CID 11184051) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is ethyl 2-[(2R,4S)-2-[(2R)-but-3-en-2-yl]-6-oxooxan-4-yl]acetate.
| Compound Name | ethyl 2-[(2R,4S)-2-[(2R)-but-3-en-2-yl]-6-oxooxan-4-yl]acetate |
|---|---|
| PubChem CID | 11184051 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | ethyl 2-[(2R,4S)-2-[(2R)-but-3-en-2-yl]-6-oxooxan-4-yl]acetate |
| SMILES | C=C[C@@H](C)[C@H]1C[C@@H](CC(=O)OCC)CC(=O)O1 |
| InChI | InChI=1S/C13H20O4/c1-4-9(3)11-6-10(8-13(15)17-11)7-12(14)16-5-2/h4,9-11H,1,5-8H2,2-3H3/t9-,10+,11-/m1/s1 |
| InChIKey | NVQQBUVOIGSKCJ-OUAUKWLOSA-N |
| XLogP | 2.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|