C11H15IO3 — CID 11290214
2-[(2R,4S)-2-[(E,2R)-4-iodobut-3-en-2-yl]-6-oxooxan-4-yl]acetaldehyde (PubChem CID 11290214) has the molecular formula C11H15IO3 and a molecular weight of 322.14 g/mol. Its IUPAC name is 2-[(2R,4S)-2-[(E,2R)-4-iodobut-3-en-2-yl]-6-oxooxan-4-yl]acetaldehyde.
| Compound Name | 2-[(2R,4S)-2-[(E,2R)-4-iodobut-3-en-2-yl]-6-oxooxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 11290214 |
| Molecular Formula | C11H15IO3 |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 2-[(2R,4S)-2-[(E,2R)-4-iodobut-3-en-2-yl]-6-oxooxan-4-yl]acetaldehyde |
| SMILES | C[C@H](/C=C/I)[C@H]1C[C@@H](CC=O)CC(=O)O1 |
| InChI | InChI=1S/C11H15IO3/c1-8(2-4-12)10-6-9(3-5-13)7-11(14)15-10/h2,4-5,8-10H,3,6-7H2,1H3/b4-2+/t8-,9-,10-/m1/s1 |
| InChIKey | HHUYRZBVHHOHLN-HZWFCMDNSA-N |
| XLogP | 2.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|