C14H18O3 — CID 138967226
2-[(2R,4S)-2-[(E,2R)-hept-3-en-5-yn-2-yl]-6-oxooxan-4-yl]acetaldehyde (PubChem CID 138967226) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-[(2R,4S)-2-[(E,2R)-hept-3-en-5-yn-2-yl]-6-oxooxan-4-yl]acetaldehyde.
| Compound Name | 2-[(2R,4S)-2-[(E,2R)-hept-3-en-5-yn-2-yl]-6-oxooxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 138967226 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-[(2R,4S)-2-[(E,2R)-hept-3-en-5-yn-2-yl]-6-oxooxan-4-yl]acetaldehyde |
| SMILES | CC#C/C=C/[C@@H](C)[C@H]1C[C@@H](CC=O)CC(=O)O1 |
| InChI | InChI=1S/C14H18O3/c1-3-4-5-6-11(2)13-9-12(7-8-15)10-14(16)17-13/h5-6,8,11-13H,7,9-10H2,1-2H3/b6-5+/t11-,12-,13-/m1/s1 |
| InChIKey | KHKNNJXYXIFMIJ-ZAGQHCIPSA-N |
| XLogP | 2.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|