C10H16O2 — CID 142114740
(5R)-3,5-dimethyl-6-prop-2-enyloxan-2-one (PubChem CID 142114740) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (5R)-3,5-dimethyl-6-prop-2-enyloxan-2-one.
| Compound Name | (5R)-3,5-dimethyl-6-prop-2-enyloxan-2-one |
|---|---|
| PubChem CID | 142114740 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (5R)-3,5-dimethyl-6-prop-2-enyloxan-2-one |
| SMILES | C=CCC1OC(=O)C(C)C[C@H]1C |
| InChI | InChI=1S/C10H16O2/c1-4-5-9-7(2)6-8(3)10(11)12-9/h4,7-9H,1,5-6H2,2-3H3/t7-,8?,9?/m1/s1 |
| InChIKey | JIVFZVRHBQDEDD-AFPNSQJFSA-N |
| XLogP | 2.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|