C23H31IN6O3 — CID 111841999
1-(3-methoxypropyl)-3-[3-(2-methylbenzimidazol-1-yl)propyl]-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111841999) has the molecular formula C23H31IN6O3 and a molecular weight of 566.44 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-[3-(2-methylbenzimidazol-1-yl)propyl]-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-methoxypropyl)-3-[3-(2-methylbenzimidazol-1-yl)propyl]-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111841999 |
| Molecular Formula | C23H31IN6O3 |
| Molecular Weight | 566.44 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | 1-(3-methoxypropyl)-3-[3-(2-methylbenzimidazol-1-yl)propyl]-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | COCCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCCCn1c(C)nc2ccccc21.I |
| InChI | InChI=1S/C23H30N6O3.HI/c1-18-27-21-7-3-4-8-22(21)28(18)15-5-13-24-23(25-14-6-16-32-2)26-17-19-9-11-20(12-10-19)29(30)31;/h3-4,7-12H,5-6,13-17H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | KYKTUKPASGHFFS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|