C18H33IN4O2 — CID 111842213
1-(2-ethoxyethyl)-2-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111842213) has the molecular formula C18H33IN4O2 and a molecular weight of 464.39 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-2-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(2-ethoxyethyl)-2-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111842213 |
| Molecular Formula | C18H33IN4O2 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-(2-ethoxyethyl)-2-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCOCCN/C(=N\CC1CCCN1CC)NCCc1ccco1.I |
| InChI | InChI=1S/C18H32N4O2.HI/c1-3-22-12-5-7-16(22)15-21-18(20-11-14-23-4-2)19-10-9-17-8-6-13-24-17;/h6,8,13,16H,3-5,7,9-12,14-15H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | UKEWJJHDEWBGTM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|