C19H28N4O2 — CID 111491336
1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]-2-(furan-2-ylmethyl)guanidine (PubChem CID 111491336) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]-2-(furan-2-ylmethyl)guanidine.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]-2-(furan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111491336 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]-2-(furan-2-ylmethyl)guanidine |
| SMILES | CCN1CCCC1CN/C(=N/Cc1ccco1)NCCc1ccco1 |
| InChI | InChI=1S/C19H28N4O2/c1-2-23-11-3-6-16(23)14-21-19(22-15-18-8-5-13-25-18)20-10-9-17-7-4-12-24-17/h4-5,7-8,12-13,16H,2-3,6,9-11,14-15H2,1H3,(H2,20,21,22) |
| InChIKey | LCFPPZCPHRICJL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|