C22H36N6O2 — CID 110052372
2-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine (PubChem CID 110052372) has the molecular formula C22H36N6O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine.
| Compound Name | 2-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 110052372 |
| Molecular Formula | C22H36N6O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 2-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]guanidine |
| SMILES | CCc1nn(C)c(OC)c1C/N=C(\NCCc1ccco1)NCC1CCCN1CC |
| InChI | InChI=1S/C22H36N6O2/c1-5-20-19(21(29-4)27(3)26-20)16-25-22(23-12-11-18-10-8-14-30-18)24-15-17-9-7-13-28(17)6-2/h8,10,14,17H,5-7,9,11-13,15-16H2,1-4H3,(H2,23,24,25) |
| InChIKey | ZVLHWRXIFIESSM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|