C15H22O3 — CID 11184274
ethyl 2-[(3aR,5S,8aS)-4-oxo-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-5-yl]prop-2-enoate (PubChem CID 11184274) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is ethyl 2-[(3aR,5S,8aS)-4-oxo-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-5-yl]prop-2-enoate.
| Compound Name | ethyl 2-[(3aR,5S,8aS)-4-oxo-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11184274 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | ethyl 2-[(3aR,5S,8aS)-4-oxo-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-5-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@@H]1CCC[C@@H]2CCC[C@H]2C1=O |
| InChI | InChI=1S/C15H22O3/c1-3-18-15(17)10(2)12-8-4-6-11-7-5-9-13(11)14(12)16/h11-13H,2-9H2,1H3/t11-,12+,13-/m1/s1 |
| InChIKey | ACQLBKRAVCNVBV-FRRDWIJNSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|