C16H32O2 — CID 11184433
2-[(2S,4S,6S)-4,6-dimethylnonan-2-yl]oxyoxane (PubChem CID 11184433) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is 2-[(2S,4S,6S)-4,6-dimethylnonan-2-yl]oxyoxane.
| Compound Name | 2-[(2S,4S,6S)-4,6-dimethylnonan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 11184433 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 2-[(2S,4S,6S)-4,6-dimethylnonan-2-yl]oxyoxane |
| SMILES | CCC[C@H](C)C[C@H](C)C[C@H](C)OC1CCCCO1 |
| InChI | InChI=1S/C16H32O2/c1-5-8-13(2)11-14(3)12-15(4)18-16-9-6-7-10-17-16/h13-16H,5-12H2,1-4H3/t13-,14-,15-,16?/m0/s1 |
| InChIKey | RYPDFMGTLAWXNM-HEHBBPHXSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |