C18H20FN3O2 — CID 111846081
1-(1,3-benzodioxol-5-ylmethyl)-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine (PubChem CID 111846081) has the molecular formula C18H20FN3O2 and a molecular weight of 329.38 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111846081 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(F)c(C)c1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H20FN3O2/c1-12-7-13(3-5-15(12)19)9-21-18(20-2)22-10-14-4-6-16-17(8-14)24-11-23-16/h3-8H,9-11H2,1-2H3,(H2,20,21,22) |
| InChIKey | VWPPIRSSFICDOY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|