C20H21F3N6O — CID 111848461
1-ethyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111848461) has the molecular formula C20H21F3N6O and a molecular weight of 418.42 g/mol. Its IUPAC name is 1-ethyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111848461 |
| Molecular Formula | C20H21F3N6O |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 1-ethyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)(F)F)NCc1nncn1-c1ccccc1 |
| InChI | InChI=1S/C20H21F3N6O/c1-2-24-19(25-12-15-8-6-7-11-17(15)30-20(21,22)23)26-13-18-28-27-14-29(18)16-9-4-3-5-10-16/h3-11,14H,2,12-13H2,1H3,(H2,24,25,26) |
| InChIKey | CYKJQUYKJMNMTQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|