C20H23IN6O2 — CID 111850539
2-methyl-1-[(3-nitrophenyl)methyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111850539) has the molecular formula C20H23IN6O2 and a molecular weight of 506.35 g/mol. Its IUPAC name is 2-methyl-1-[(3-nitrophenyl)methyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-nitrophenyl)methyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111850539 |
| Molecular Formula | C20H23IN6O2 |
| Molecular Weight | 506.35 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 2-methyl-1-[(3-nitrophenyl)methyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc([N+](=O)[O-])c1)NCc1ccccc1Cn1cccn1.I |
| InChI | InChI=1S/C20H22N6O2.HI/c1-21-20(22-13-16-6-4-9-19(12-16)26(27)28)23-14-17-7-2-3-8-18(17)15-25-11-5-10-24-25;/h2-12H,13-15H2,1H3,(H2,21,22,23);1H |
| InChIKey | GLTPJCSKITUXNQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|