C26H32IN7 — CID 111851585
2-methyl-1-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111851585) has the molecular formula C26H32IN7 and a molecular weight of 569.50 g/mol. Its IUPAC name is 2-methyl-1-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111851585 |
| Molecular Formula | C26H32IN7 |
| Molecular Weight | 569.50 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 2-methyl-1-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1cn(-c2ccccc2)nc1C)NCc1ccccc1Cn1cccn1.I |
| InChI | InChI=1S/C26H31N7.HI/c1-21-23(20-33(31-21)25-13-4-3-5-14-25)12-8-15-28-26(27-2)29-18-22-10-6-7-11-24(22)19-32-17-9-16-30-32;/h3-7,9-11,13-14,16-17,20H,8,12,15,18-19H2,1-2H3,(H2,27,28,29);1H |
| InChIKey | LHHCLMIPAOTXTQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|