C23H28F2IN5O — CID 111865743
1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]guanidine;hydroiodide (PubChem CID 111865743) has the molecular formula C23H28F2IN5O and a molecular weight of 555.41 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111865743 |
| Molecular Formula | C23H28F2IN5O |
| Molecular Weight | 555.41 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1cn(-c2ccccc2)nc1C)NCc1ccccc1OC(F)F.I |
| InChI | InChI=1S/C23H27F2N5O.HI/c1-17-19(16-30(29-17)20-11-4-3-5-12-20)10-8-14-27-23(26-2)28-15-18-9-6-7-13-21(18)31-22(24)25;/h3-7,9,11-13,16,22H,8,10,14-15H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | WVYQYMNHCSSTJP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|