C25H33N7O — CID 111852246
1-ethyl-2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111852246) has the molecular formula C25H33N7O and a molecular weight of 447.59 g/mol. Its IUPAC name is 1-ethyl-2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111852246 |
| Molecular Formula | C25H33N7O |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 1-ethyl-2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCOC(C)C2)nc1)NCc1ccccc1Cn1cccn1 |
| InChI | InChI=1S/C25H33N7O/c1-3-26-25(29-17-22-7-4-5-8-23(22)19-32-12-6-11-30-32)28-16-21-9-10-24(27-15-21)31-13-14-33-20(2)18-31/h4-12,15,20H,3,13-14,16-19H2,1-2H3,(H2,26,28,29) |
| InChIKey | PSTOVVRMKUYFNJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|