C26H35N7 — CID 111852020
2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111852020) has the molecular formula C26H35N7 and a molecular weight of 445.62 g/mol. Its IUPAC name is 2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111852020 |
| Molecular Formula | C26H35N7 |
| Molecular Weight | 445.62 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | 2-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-1-ethyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCCCCC2)nc1)NCc1ccccc1Cn1cccn1 |
| InChI | InChI=1S/C26H35N7/c1-2-27-26(30-20-23-10-5-6-11-24(23)21-33-17-9-14-31-33)29-19-22-12-13-25(28-18-22)32-15-7-3-4-8-16-32/h5-6,9-14,17-18H,2-4,7-8,15-16,19-21H2,1H3,(H2,27,29,30) |
| InChIKey | WPOCYRMXIUIIHW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|