C24H33IN4O2 — CID 111852533
2-[4-[2-[[N'-methyl-N-[(1-phenylcyclopentyl)methyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide (PubChem CID 111852533) has the molecular formula C24H33IN4O2 and a molecular weight of 536.46 g/mol. Its IUPAC name is 2-[4-[2-[[N'-methyl-N-[(1-phenylcyclopentyl)methyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[4-[2-[[N'-methyl-N-[(1-phenylcyclopentyl)methyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111852533 |
| Molecular Formula | C24H33IN4O2 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 2-[4-[2-[[N'-methyl-N-[(1-phenylcyclopentyl)methyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(OCC(N)=O)cc1)NCC1(c2ccccc2)CCCC1.I |
| InChI | InChI=1S/C24H32N4O2.HI/c1-26-23(27-16-13-19-9-11-21(12-10-19)30-17-22(25)29)28-18-24(14-5-6-15-24)20-7-3-2-4-8-20;/h2-4,7-12H,5-6,13-18H2,1H3,(H2,25,29)(H2,26,27,28);1H |
| InChIKey | UAULPPCNUGKMAE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|