C24H34N6 — CID 111855700
1-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine (PubChem CID 111855700) has the molecular formula C24H34N6 and a molecular weight of 406.58 g/mol. Its IUPAC name is 1-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine.
| Compound Name | 1-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine |
|---|---|
| PubChem CID | 111855700 |
| Molecular Formula | C24H34N6 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | 1-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine |
| SMILES | CCN1CCN(c2cc(CN/C(=N/C)NCC3(c4ccccc4)CC3)ccn2)CC1 |
| InChI | InChI=1S/C24H34N6/c1-3-29-13-15-30(16-14-29)22-17-20(9-12-26-22)18-27-23(25-2)28-19-24(10-11-24)21-7-5-4-6-8-21/h4-9,12,17H,3,10-11,13-16,18-19H2,1-2H3,(H2,25,27,28) |
| InChIKey | ZVNOCPWUPPEFIU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|