C21H26N4O — CID 36964043
1-[(1-phenylcyclopropyl)methyl]-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea (PubChem CID 36964043) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 1-[(1-phenylcyclopropyl)methyl]-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-[(1-phenylcyclopropyl)methyl]-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 36964043 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1-[(1-phenylcyclopropyl)methyl]-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1ccnc(N2CCCC2)c1)NCC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N4O/c26-20(24-16-21(9-10-21)18-6-2-1-3-7-18)23-15-17-8-11-22-19(14-17)25-12-4-5-13-25/h1-3,6-8,11,14H,4-5,9-10,12-13,15-16H2,(H2,23,24,26) |
| InChIKey | VFYXIBGVNNFRMU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |