C23H26F3N3O3 — CID 111856476
1-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111856476) has the molecular formula C23H26F3N3O3 and a molecular weight of 449.47 g/mol. Its IUPAC name is 1-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111856476 |
| Molecular Formula | C23H26F3N3O3 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 1-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | C#CCOc1cc(CN/C(=N/C)NCc2ccc(COCC(F)(F)F)cc2)ccc1OC |
| InChI | InChI=1S/C23H26F3N3O3/c1-4-11-32-21-12-19(9-10-20(21)30-3)14-29-22(27-2)28-13-17-5-7-18(8-6-17)15-31-16-23(24,25)26/h1,5-10,12H,11,13-16H2,2-3H3,(H2,27,28,29) |
| InChIKey | GVKFZQFNLWRAHZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|