C21H25IN4 — CID 111857329
1-(1H-indol-2-ylmethyl)-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide (PubChem CID 111857329) has the molecular formula C21H25IN4 and a molecular weight of 460.36 g/mol. Its IUPAC name is 1-(1H-indol-2-ylmethyl)-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1H-indol-2-ylmethyl)-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111857329 |
| Molecular Formula | C21H25IN4 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 1-(1H-indol-2-ylmethyl)-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc2ccccc2[nH]1)NCC1(c2ccccc2)CC1.I |
| InChI | InChI=1S/C21H24N4.HI/c1-22-20(23-14-18-13-16-7-5-6-10-19(16)25-18)24-15-21(11-12-21)17-8-3-2-4-9-17;/h2-10,13,25H,11-12,14-15H2,1H3,(H2,22,23,24);1H |
| InChIKey | AEENAXVLXBKBRC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|