C23H27F3N4O2 — CID 111857817
1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111857817) has the molecular formula C23H27F3N4O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111857817 |
| Molecular Formula | C23H27F3N4O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(COCC(F)(F)F)cc1)NCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C23H27F3N4O2/c1-2-27-22(29-14-21(31)30-12-11-19-5-3-4-6-20(19)30)28-13-17-7-9-18(10-8-17)15-32-16-23(24,25)26/h3-10H,2,11-16H2,1H3,(H2,27,28,29) |
| InChIKey | OSBQYIJMYVJIGB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|