C20H22F2N4O — CID 111903037
2-[(2,5-difluorophenyl)methyl]-1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-ethylguanidine (PubChem CID 111903037) has the molecular formula C20H22F2N4O and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-ethylguanidine.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111903037 |
| Molecular Formula | C20H22F2N4O |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H22F2N4O/c1-2-23-20(24-12-15-11-16(21)7-8-17(15)22)25-13-19(27)26-10-9-14-5-3-4-6-18(14)26/h3-8,11H,2,9-10,12-13H2,1H3,(H2,23,24,25) |
| InChIKey | APHDQKIRFKMNGR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|