C21H26F2N4O — CID 111902301
N-benzyl-2-[[N'-[(2,5-difluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-ethylacetamide (PubChem CID 111902301) has the molecular formula C21H26F2N4O and a molecular weight of 388.46 g/mol. Its IUPAC name is N-benzyl-2-[[N'-[(2,5-difluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-ethylacetamide.
| Compound Name | N-benzyl-2-[[N'-[(2,5-difluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 111902301 |
| Molecular Formula | C21H26F2N4O |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | N-benzyl-2-[[N'-[(2,5-difluorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-ethylacetamide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCC(=O)N(CC)Cc1ccccc1 |
| InChI | InChI=1S/C21H26F2N4O/c1-3-24-21(25-13-17-12-18(22)10-11-19(17)23)26-14-20(28)27(4-2)15-16-8-6-5-7-9-16/h5-12H,3-4,13-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | FBBTXIBVLHKJQN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|