C17H28F2N4 — CID 111901981
2-[(2,5-difluorophenyl)methyl]-1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-ethylguanidine (PubChem CID 111901981) has the molecular formula C17H28F2N4 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-ethylguanidine.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111901981 |
| Molecular Formula | C17H28F2N4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCC(C)(C)CN(C)C |
| InChI | InChI=1S/C17H28F2N4/c1-6-20-16(22-11-17(2,3)12-23(4)5)21-10-13-9-14(18)7-8-15(13)19/h7-9H,6,10-12H2,1-5H3,(H2,20,21,22) |
| InChIKey | ZSQKFKRTMHDTQT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|