C22H36F3N5O — CID 111857947
1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111857947) has the molecular formula C22H36F3N5O and a molecular weight of 443.56 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111857947 |
| Molecular Formula | C22H36F3N5O |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | 1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(COCC(F)(F)F)cc1)NCCCN1CCCN(C)CC1 |
| InChI | InChI=1S/C22H36F3N5O/c1-3-26-21(27-10-4-12-30-13-5-11-29(2)14-15-30)28-16-19-6-8-20(9-7-19)17-31-18-22(23,24)25/h6-9H,3-5,10-18H2,1-2H3,(H2,26,27,28) |
| InChIKey | IBZGJXKTNALXRL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|