C21H24F4IN3O — CID 111857984
1-[2-(2-fluorophenyl)cyclopropyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111857984) has the molecular formula C21H24F4IN3O and a molecular weight of 537.34 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)cyclopropyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-fluorophenyl)cyclopropyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111857984 |
| Molecular Formula | C21H24F4IN3O |
| Molecular Weight | 537.34 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | 1-[2-(2-fluorophenyl)cyclopropyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(COCC(F)(F)F)cc1)NC1CC1c1ccccc1F.I |
| InChI | InChI=1S/C21H23F4N3O.HI/c1-26-20(28-19-10-17(19)16-4-2-3-5-18(16)22)27-11-14-6-8-15(9-7-14)12-29-13-21(23,24)25;/h2-9,17,19H,10-13H2,1H3,(H2,26,27,28);1H |
| InChIKey | ROSAKWOECJUWOU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|