C23H30N4O3 — CID 111862529
3-[[N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N'-[(2-methylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylpropanamide (PubChem CID 111862529) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-[[N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N'-[(2-methylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylpropanamide.
| Compound Name | 3-[[N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N'-[(2-methylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 111862529 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 3-[[N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N'-[(2-methylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylpropanamide |
| SMILES | Cc1ccccc1C/N=C(\NCCC(=O)N(C)C)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C23H30N4O3/c1-17-7-4-5-8-18(17)16-25-23(24-12-11-22(28)27(2)3)26-19-9-10-20-21(15-19)30-14-6-13-29-20/h4-5,7-10,15H,6,11-14,16H2,1-3H3,(H2,24,25,26) |
| InChIKey | HRQPELDWUGBXMX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|