C25H28N4O2 — CID 111862685
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(2-methylphenyl)methyl]-3-[(6-methyl-2-pyridinyl)methyl]guanidine (PubChem CID 111862685) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(2-methylphenyl)methyl]-3-[(6-methyl-2-pyridinyl)methyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(2-methylphenyl)methyl]-3-[(6-methyl-2-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111862685 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(2-methylphenyl)methyl]-3-[(6-methyl-2-pyridinyl)methyl]guanidine |
| SMILES | Cc1cccc(CN/C(=N\Cc2ccccc2C)Nc2ccc3c(c2)OCCCO3)n1 |
| InChI | InChI=1S/C25H28N4O2/c1-18-7-3-4-9-20(18)16-26-25(27-17-22-10-5-8-19(2)28-22)29-21-11-12-23-24(15-21)31-14-6-13-30-23/h3-5,7-12,15H,6,13-14,16-17H2,1-2H3,(H2,26,27,29) |
| InChIKey | DXKFEGGCLJKSCE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|