C16H20O7 — CID 11186382
(4R,7E,10S,13E,16S)-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12,15-tetrone (PubChem CID 11186382) has the molecular formula C16H20O7 and a molecular weight of 324.33 g/mol. Its IUPAC name is (4R,7E,10S,13E,16S)-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12,15-tetrone.
| Compound Name | (4R,7E,10S,13E,16S)-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12,15-tetrone |
|---|---|
| PubChem CID | 11186382 |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (4R,7E,10S,13E,16S)-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12,15-tetrone |
| SMILES | C[C@@H]1CC(=O)O[C@@H](C)C(=O)/C=C/C(=O)O[C@@H](C)C/C=C/C(=O)O1 |
| InChI | InChI=1S/C16H20O7/c1-10-5-4-6-14(18)22-11(2)9-16(20)23-12(3)13(17)7-8-15(19)21-10/h4,6-8,10-12H,5,9H2,1-3H3/b6-4+,8-7+/t10-,11+,12-/m0/s1 |
| InChIKey | KJWGTIJRAZSVAK-BFZSZLPQSA-N |
| XLogP | 1.26 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|