C19H28F3IN6 — CID 111864547
2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111864547) has the molecular formula C19H28F3IN6 and a molecular weight of 524.37 g/mol. Its IUPAC name is 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111864547 |
| Molecular Formula | C19H28F3IN6 |
| Molecular Weight | 524.37 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NCCc1ccc(-n2cccn2)cc1.I |
| InChI | InChI=1S/C19H27F3N6.HI/c1-23-18(24-10-3-13-27(2)15-19(20,21)22)25-12-9-16-5-7-17(8-6-16)28-14-4-11-26-28;/h4-8,11,14H,3,9-10,12-13,15H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | BWKLISYMGHRPCV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|