C25H33IN6 — CID 111863781
1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111863781) has the molecular formula C25H33IN6 and a molecular weight of 544.49 g/mol. Its IUPAC name is 1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111863781 |
| Molecular Formula | C25H33IN6 |
| Molecular Weight | 544.49 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 1-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCc2ccccc2C1)NCCc1ccc(-n2cccn2)cc1.I |
| InChI | InChI=1S/C25H32N6.HI/c1-26-25(27-14-4-17-30-19-13-22-6-2-3-7-23(22)20-30)28-16-12-21-8-10-24(11-9-21)31-18-5-15-29-31;/h2-3,5-11,15,18H,4,12-14,16-17,19-20H2,1H3,(H2,26,27,28);1H |
| InChIKey | DHRCFOSWFCFQBV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|