C21H28FIN4 — CID 111230424
1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111230424) has the molecular formula C21H28FIN4 and a molecular weight of 482.39 g/mol. Its IUPAC name is 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111230424 |
| Molecular Formula | C21H28FIN4 |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(F)cc1)NCCN1CCc2ccccc2C1.I |
| InChI | InChI=1S/C21H27FN4.HI/c1-23-21(24-12-10-17-6-8-20(22)9-7-17)25-13-15-26-14-11-18-4-2-3-5-19(18)16-26;/h2-9H,10-16H2,1H3,(H2,23,24,25);1H |
| InChIKey | YNRLIQJPYXZVQO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|