C20H31F2IN4O2S — CID 111864919
2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111864919) has the molecular formula C20H31F2IN4O2S and a molecular weight of 556.46 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111864919 |
| Molecular Formula | C20H31F2IN4O2S |
| Molecular Weight | 556.46 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 2-[[2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)F)NCC1(N2CCOCC2)CCSC1.I |
| InChI | InChI=1S/C20H30F2N4O2S.HI/c1-2-23-19(24-13-16-5-3-4-6-17(16)28-18(21)22)25-14-20(7-12-29-15-20)26-8-10-27-11-9-26;/h3-6,18H,2,7-15H2,1H3,(H2,23,24,25);1H |
| InChIKey | CRIBFLPTEVQJCK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|