C20H28F4N4OS — CID 111889355
1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine (PubChem CID 111889355) has the molecular formula C20H28F4N4OS and a molecular weight of 448.53 g/mol. Its IUPAC name is 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111889355 |
| Molecular Formula | C20H28F4N4OS |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1C(F)(F)F)NCC1(N2CCOCC2)CCSC1 |
| InChI | InChI=1S/C20H28F4N4OS/c1-2-25-18(26-12-15-3-4-16(21)11-17(15)20(22,23)24)27-13-19(5-10-30-14-19)28-6-8-29-9-7-28/h3-4,11H,2,5-10,12-14H2,1H3,(H2,25,26,27) |
| InChIKey | KSUGXEOMGGGMAU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|