C19H23F2N5O2 — CID 111866236
3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide (PubChem CID 111866236) has the molecular formula C19H23F2N5O2 and a molecular weight of 391.42 g/mol. Its IUPAC name is 3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 111866236 |
| Molecular Formula | C19H23F2N5O2 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-N-(5-methyl-2-pyridinyl)propanamide |
| SMILES | C/N=C(\NCCC(=O)Nc1ccc(C)cn1)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C19H23F2N5O2/c1-13-7-8-16(24-11-13)26-17(27)9-10-23-19(22-2)25-12-14-5-3-4-6-15(14)28-18(20)21/h3-8,11,18H,9-10,12H2,1-2H3,(H2,22,23,25)(H,24,26,27) |
| InChIKey | PLPCJVHPJQNRFL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|