C15H21F2N3O3 — CID 111866418
methyl 3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate (PubChem CID 111866418) has the molecular formula C15H21F2N3O3 and a molecular weight of 329.35 g/mol. Its IUPAC name is methyl 3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate.
| Compound Name | methyl 3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 111866418 |
| Molecular Formula | C15H21F2N3O3 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | methyl 3-[[N-[[2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate |
| SMILES | C/N=C(/NCc1ccccc1OC(F)F)NCC(C)C(=O)OC |
| InChI | InChI=1S/C15H21F2N3O3/c1-10(13(21)22-3)8-19-15(18-2)20-9-11-6-4-5-7-12(11)23-14(16)17/h4-7,10,14H,8-9H2,1-3H3,(H2,18,19,20) |
| InChIKey | GCNNJLLVZVOIHW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|