C21H30IN5O3S — CID 111867055
N-tert-butyl-2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[(4-methyl-1,3-thiazol-5-yl)methylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 111867055) has the molecular formula C21H30IN5O3S and a molecular weight of 559.47 g/mol. Its IUPAC name is N-tert-butyl-2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[(4-methyl-1,3-thiazol-5-yl)methylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[(4-methyl-1,3-thiazol-5-yl)methylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111867055 |
| Molecular Formula | C21H30IN5O3S |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | N-tert-butyl-2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[(4-methyl-1,3-thiazol-5-yl)methylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | Cc1ncsc1CN/C(=N\CC(=O)NC(C)(C)C)Nc1ccc2c(c1)OCCCO2.I |
| InChI | InChI=1S/C21H29N5O3S.HI/c1-14-18(30-13-24-14)11-22-20(23-12-19(27)26-21(2,3)4)25-15-6-7-16-17(10-15)29-9-5-8-28-16;/h6-7,10,13H,5,8-9,11-12H2,1-4H3,(H,26,27)(H2,22,23,25);1H |
| InChIKey | WKYGIYIRQHALGZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|