C22H30N4O3S — CID 111867082
N-tert-butyl-2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]acetamide (PubChem CID 111867082) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-tert-butyl-2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111867082 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-tert-butyl-2-[[(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]acetamide |
| SMILES | Cc1ccc(CN/C(=N\CC(=O)NC(C)(C)C)Nc2ccc3c(c2)OCCCO3)s1 |
| InChI | InChI=1S/C22H30N4O3S/c1-15-6-8-17(30-15)13-23-21(24-14-20(27)26-22(2,3)4)25-16-7-9-18-19(12-16)29-11-5-10-28-18/h6-9,12H,5,10-11,13-14H2,1-4H3,(H,26,27)(H2,23,24,25) |
| InChIKey | NFNWZISFVXQOSE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|