C19H36O3Si — CID 11186872
ethyl (2Z)-2-[(2S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,3-trimethylcyclopentylidene]acetate (PubChem CID 11186872) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is ethyl (2Z)-2-[(2S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,3-trimethylcyclopentylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(2S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,3-trimethylcyclopentylidene]acetate |
|---|---|
| PubChem CID | 11186872 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | ethyl (2Z)-2-[(2S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,3-trimethylcyclopentylidene]acetate |
| SMILES | CCOC(=O)/C=C1/C[C@@H](CO[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H]1C |
| InChI | InChI=1S/C19H36O3Si/c1-10-21-17(20)12-15-11-16(19(6,7)14(15)2)13-22-23(8,9)18(3,4)5/h12,14,16H,10-11,13H2,1-9H3/b15-12-/t14-,16+/m1/s1 |
| InChIKey | WYSBWMVGYFFYIC-USTAHWGDSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|