C19H22FN3 — CID 111876643
1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine (PubChem CID 111876643) has the molecular formula C19H22FN3 and a molecular weight of 311.40 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111876643 |
| Molecular Formula | C19H22FN3 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(F)c1)NCC1Cc2ccccc21 |
| InChI | InChI=1S/C19H22FN3/c1-2-21-19(22-12-14-6-5-8-17(20)10-14)23-13-16-11-15-7-3-4-9-18(15)16/h3-10,16H,2,11-13H2,1H3,(H2,21,22,23) |
| InChIKey | NZWOVUBQCIJVFQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|