C16H30F3N5O2 — CID 111884329
tert-butyl N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]carbamate (PubChem CID 111884329) has the molecular formula C16H30F3N5O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is tert-butyl N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111884329 |
| Molecular Formula | C16H30F3N5O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | tert-butyl N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CCNC(=O)OC(C)(C)C)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C16H30F3N5O2/c1-5-20-13(21-7-8-22-14(25)26-15(2,3)4)23-12-6-9-24(10-12)11-16(17,18)19/h12H,5-11H2,1-4H3,(H,22,25)(H2,20,21,23) |
| InChIKey | HXNOSJFCJULESG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|