C22H34O4Si — CID 11188466
(1S)-1-[(2R,3S,4S)-3-methyl-4-triethylsilyloxy-3,4-dihydro-2H-pyran-2-yl]-1-phenylmethoxypropan-2-one (PubChem CID 11188466) has the molecular formula C22H34O4Si and a molecular weight of 390.60 g/mol. Its IUPAC name is (1S)-1-[(2R,3S,4S)-3-methyl-4-triethylsilyloxy-3,4-dihydro-2H-pyran-2-yl]-1-phenylmethoxypropan-2-one.
| Compound Name | (1S)-1-[(2R,3S,4S)-3-methyl-4-triethylsilyloxy-3,4-dihydro-2H-pyran-2-yl]-1-phenylmethoxypropan-2-one |
|---|---|
| PubChem CID | 11188466 |
| Molecular Formula | C22H34O4Si |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (1S)-1-[(2R,3S,4S)-3-methyl-4-triethylsilyloxy-3,4-dihydro-2H-pyran-2-yl]-1-phenylmethoxypropan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C=CO[C@@H]([C@H](OCc2ccccc2)C(C)=O)[C@@H]1C |
| InChI | InChI=1S/C22H34O4Si/c1-6-27(7-2,8-3)26-20-14-15-24-21(17(20)4)22(18(5)23)25-16-19-12-10-9-11-13-19/h9-15,17,20-22H,6-8,16H2,1-5H3/t17-,20+,21-,22-/m1/s1 |
| InChIKey | NCRXBSFOXBGETJ-XYEHWOGUSA-N |
| XLogP | 5.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|