C19H34N6O2 — CID 111885063
tert-butyl N-[2-[[N-[[6-(diethylamino)-3-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate (PubChem CID 111885063) has the molecular formula C19H34N6O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[[6-(diethylamino)-3-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-[[6-(diethylamino)-3-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111885063 |
| Molecular Formula | C19H34N6O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | tert-butyl N-[2-[[N-[[6-(diethylamino)-3-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN(CC)c1ccc(CN/C(=N/C)NCCNC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C19H34N6O2/c1-7-25(8-2)16-10-9-15(13-23-16)14-24-17(20-6)21-11-12-22-18(26)27-19(3,4)5/h9-10,13H,7-8,11-12,14H2,1-6H3,(H,22,26)(H2,20,21,24) |
| InChIKey | DAKKCADKHVQJHW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|