C20H36N6O2 — CID 111887139
tert-butyl N-[3-[[N-[[6-(diethylamino)-3-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111887139) has the molecular formula C20H36N6O2 and a molecular weight of 392.55 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[[6-(diethylamino)-3-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-[[6-(diethylamino)-3-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887139 |
| Molecular Formula | C20H36N6O2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | tert-butyl N-[3-[[N-[[6-(diethylamino)-3-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN(CC)c1ccc(CN/C(=N/C)NCCCNC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C20H36N6O2/c1-7-26(8-2)17-11-10-16(14-24-17)15-25-18(21-6)22-12-9-13-23-19(27)28-20(3,4)5/h10-11,14H,7-9,12-13,15H2,1-6H3,(H,23,27)(H2,21,22,25) |
| InChIKey | MOEXBQFRCNIURE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|